C21H35ClIN5O3 — CID 111886470
tert-butyl N-[3-[[[[3-(3-chloro-2-methylanilino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111886470) has the molecular formula C21H35ClIN5O3 and a molecular weight of 567.90 g/mol. Its IUPAC name is tert-butyl N-[3-[[[[3-(3-chloro-2-methylanilino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[[[3-(3-chloro-2-methylanilino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886470 |
| Molecular Formula | C21H35ClIN5O3 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | tert-butyl N-[3-[[[[3-(3-chloro-2-methylanilino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCC(=O)Nc1cccc(Cl)c1C.I |
| InChI | InChI=1S/C21H34ClN5O3.HI/c1-6-23-19(24-12-8-13-26-20(29)30-21(3,4)5)25-14-11-18(28)27-17-10-7-9-16(22)15(17)2;/h7,9-10H,6,8,11-14H2,1-5H3,(H,26,29)(H,27,28)(H2,23,24,25);1H |
| InChIKey | JHXORASORWNTBQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|