C16H21ClN4O — CID 136921937
N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propanamide (PubChem CID 136921937) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 136921937 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(prop-2-ynylamino)methylidene]amino]propanamide |
| SMILES | C#CCN/C(=N/CCC(=O)Nc1cccc(Cl)c1C)NCC |
| InChI | InChI=1S/C16H21ClN4O/c1-4-10-19-16(18-5-2)20-11-9-15(22)21-14-8-6-7-13(17)12(14)3/h1,6-8H,5,9-11H2,2-3H3,(H,21,22)(H2,18,19,20) |
| InChIKey | QGJARPNKESOVND-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|