C20H36IN5O2 — CID 111886488
tert-butyl N-[3-[[(3-anilinopropylamino)-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111886488) has the molecular formula C20H36IN5O2 and a molecular weight of 505.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3-anilinopropylamino)-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[(3-anilinopropylamino)-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886488 |
| Molecular Formula | C20H36IN5O2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | tert-butyl N-[3-[[(3-anilinopropylamino)-(ethylamino)methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCCNc1ccccc1.I |
| InChI | InChI=1S/C20H35N5O2.HI/c1-5-21-18(23-14-9-13-22-17-11-7-6-8-12-17)24-15-10-16-25-19(26)27-20(2,3)4;/h6-8,11-12,22H,5,9-10,13-16H2,1-4H3,(H,25,26)(H2,21,23,24);1H |
| InChIKey | GXNUTYYRYVSHKM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|