C16H27N5O3S2 — CID 111535859
N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111535859) has the molecular formula C16H27N5O3S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111535859 |
| Molecular Formula | C16H27N5O3S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H27N5O3S2/c1-3-13-9-19-15(25-13)10-20-16(17-4-2)18-7-5-14(22)21-12-6-8-26(23,24)11-12/h9,12H,3-8,10-11H2,1-2H3,(H,21,22)(H2,17,18,20) |
| InChIKey | CSWWUTZXHIVUGL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|