C16H32N4O3S — CID 111891139
N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]propanamide (PubChem CID 111891139) has the molecular formula C16H32N4O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111891139 |
| Molecular Formula | C16H32N4O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-ethyl-N'-(2-ethylbutyl)carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CC(CC)CC)NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H32N4O3S/c1-4-13(5-2)11-19-16(17-6-3)18-9-7-15(21)20-14-8-10-24(22,23)12-14/h13-14H,4-12H2,1-3H3,(H,20,21)(H2,17,18,19) |
| InChIKey | CUNUUAZJWHRXRP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|