C10H19N3O3S2 — CID 43076178
N-(1,1-dioxothiolan-3-yl)-3-(ethylcarbamothioylamino)propanamide (PubChem CID 43076178) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(ethylcarbamothioylamino)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(ethylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 43076178 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(ethylcarbamothioylamino)propanamide |
| SMILES | CCNC(=S)NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N3O3S2/c1-2-11-10(17)12-5-3-9(14)13-8-4-6-18(15,16)7-8/h8H,2-7H2,1H3,(H,13,14)(H2,11,12,17) |
| InChIKey | YKBAMZZGHGXQLV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|