C8H16N2O2S2 — CID 74645340
1-(1,1-dioxothiolan-3-yl)-3-propylthiourea (PubChem CID 74645340) has the molecular formula C8H16N2O2S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-propylthiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-propylthiourea |
|---|---|
| PubChem CID | 74645340 |
| Molecular Formula | C8H16N2O2S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-propylthiourea |
| SMILES | CCCNC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16N2O2S2/c1-2-4-9-8(13)10-7-3-5-14(11,12)6-7/h7H,2-6H2,1H3,(H2,9,10,13) |
| InChIKey | OKDQYQSBBFMRDG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|