C14H19N3O4S — CID 109077860
4-N-(1,1-dioxothiolan-3-yl)-2-N-propylpyridine-2,4-dicarboxamide (PubChem CID 109077860) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-2-N-propylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109077860 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-2-N-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1cc(C(=O)NC2CCS(=O)(=O)C2)ccn1 |
| InChI | InChI=1S/C14H19N3O4S/c1-2-5-16-14(19)12-8-10(3-6-15-12)13(18)17-11-4-7-22(20,21)9-11/h3,6,8,11H,2,4-5,7,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | OFGSRMASSNBVPB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |