C17H16FN3O4S — CID 109088375
2-N-(1,1-dioxothiolan-3-yl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109088375) has the molecular formula C17H16FN3O4S and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088375 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-4-N-(3-fluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccnc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H16FN3O4S/c18-12-2-1-3-13(9-12)20-16(22)11-4-6-19-15(8-11)17(23)21-14-5-7-26(24,25)10-14/h1-4,6,8-9,14H,5,7,10H2,(H,20,22)(H,21,23) |
| InChIKey | UJZRAVWZLDBKMM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |