C16H16FN3O3S — CID 109214858
N-(1,1-dioxothiolan-3-yl)-4-(2-fluoroanilino)pyridine-2-carboxamide (PubChem CID 109214858) has the molecular formula C16H16FN3O3S and a molecular weight of 349.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(2-fluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(2-fluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109214858 |
| Molecular Formula | C16H16FN3O3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(2-fluoroanilino)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc(Nc2ccccc2F)ccn1 |
| InChI | InChI=1S/C16H16FN3O3S/c17-13-3-1-2-4-14(13)19-11-5-7-18-15(9-11)16(21)20-12-6-8-24(22,23)10-12/h1-5,7,9,12H,6,8,10H2,(H,18,19)(H,20,21) |
| InChIKey | LMMFSWADFPYHBY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |