C13H19N3O3S — CID 63917314
N-(1,1-dioxothian-3-yl)-4-(ethylamino)pyridine-2-carboxamide (PubChem CID 63917314) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-4-(ethylamino)pyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-4-(ethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63917314 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-4-(ethylamino)pyridine-2-carboxamide |
| SMILES | CCNc1ccnc(C(=O)NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19N3O3S/c1-2-14-10-5-6-15-12(8-10)13(17)16-11-4-3-7-20(18,19)9-11/h5-6,8,11H,2-4,7,9H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | CMUHEMWTXREDFA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |