C15H23N3O3S — CID 109214826
N-(1,1-dioxothiolan-3-yl)-4-(3-methylbutylamino)pyridine-2-carboxamide (PubChem CID 109214826) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(3-methylbutylamino)pyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(3-methylbutylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109214826 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(3-methylbutylamino)pyridine-2-carboxamide |
| SMILES | CC(C)CCNc1ccnc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H23N3O3S/c1-11(2)3-6-16-12-4-7-17-14(9-12)15(19)18-13-5-8-22(20,21)10-13/h4,7,9,11,13H,3,5-6,8,10H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ZSEQTYXVEGRZPX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |