C11H15N3O3S — CID 63923173
4-[(1,1-dioxothian-3-yl)amino]pyridine-2-carboxamide (PubChem CID 63923173) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)amino]pyridine-2-carboxamide.
| Compound Name | 4-[(1,1-dioxothian-3-yl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63923173 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)amino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NC2CCCS(=O)(=O)C2)ccn1 |
| InChI | InChI=1S/C11H15N3O3S/c12-11(15)10-6-8(3-4-13-10)14-9-2-1-5-18(16,17)7-9/h3-4,6,9H,1-2,5,7H2,(H2,12,15)(H,13,14) |
| InChIKey | JAZCUEIXEWVZKW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |