C16H24N4O — CID 154797079
4-[(1-cyclopentylpiperidin-4-yl)amino]pyridine-2-carboxamide (PubChem CID 154797079) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[(1-cyclopentylpiperidin-4-yl)amino]pyridine-2-carboxamide.
| Compound Name | 4-[(1-cyclopentylpiperidin-4-yl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154797079 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-[(1-cyclopentylpiperidin-4-yl)amino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NC2CCN(C3CCCC3)CC2)ccn1 |
| InChI | InChI=1S/C16H24N4O/c17-16(21)15-11-13(5-8-18-15)19-12-6-9-20(10-7-12)14-3-1-2-4-14/h5,8,11-12,14H,1-4,6-7,9-10H2,(H2,17,21)(H,18,19) |
| InChIKey | OCTXWILEZOXWTJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |