C15H16ClN5O — CID 154794198
4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]pyridine-2-carboxamide (PubChem CID 154794198) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154794198 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NC2CCN(c3ncccc3Cl)C2)ccn1 |
| InChI | InChI=1S/C15H16ClN5O/c16-12-2-1-5-19-15(12)21-7-4-11(9-21)20-10-3-6-18-13(8-10)14(17)22/h1-3,5-6,8,11H,4,7,9H2,(H2,17,22)(H,18,20) |
| InChIKey | GOVXFHWVELISSV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |