C17H16Cl2N4O4 — CID 133369032
methyl 2-chloro-4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-5-nitrobenzoate (PubChem CID 133369032) has the molecular formula C17H16Cl2N4O4 and a molecular weight of 411.25 g/mol. Its IUPAC name is methyl 2-chloro-4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133369032 |
| Molecular Formula | C17H16Cl2N4O4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 2-chloro-4-[[1-(3-chloro-2-pyridinyl)pyrrolidin-3-yl]amino]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(NC2CCN(c3ncccc3Cl)C2)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N4O4/c1-27-17(24)11-7-15(23(25)26)14(8-13(11)19)21-10-4-6-22(9-10)16-12(18)3-2-5-20-16/h2-3,5,7-8,10,21H,4,6,9H2,1H3 |
| InChIKey | NVHOULSODOBHRD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|