C16H17ClN4O4S — CID 133414404
1-(3-chloro-2-pyridinyl)-N-(3-methylsulfonyl-2-nitrophenyl)pyrrolidin-3-amine (PubChem CID 133414404) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-(3-methylsulfonyl-2-nitrophenyl)pyrrolidin-3-amine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-(3-methylsulfonyl-2-nitrophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 133414404 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-(3-methylsulfonyl-2-nitrophenyl)pyrrolidin-3-amine |
| SMILES | CS(=O)(=O)c1cccc(NC2CCN(c3ncccc3Cl)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17ClN4O4S/c1-26(24,25)14-6-2-5-13(15(14)21(22)23)19-11-7-9-20(10-11)16-12(17)4-3-8-18-16/h2-6,8,11,19H,7,9-10H2,1H3 |
| InChIKey | PYHJAYASEZHATP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|