C12H17N3O4S — CID 82878658
N-(3-methylsulfonyl-2-nitrophenyl)piperidin-1-amine (PubChem CID 82878658) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(3-methylsulfonyl-2-nitrophenyl)piperidin-1-amine.
| Compound Name | N-(3-methylsulfonyl-2-nitrophenyl)piperidin-1-amine |
|---|---|
| PubChem CID | 82878658 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(3-methylsulfonyl-2-nitrophenyl)piperidin-1-amine |
| SMILES | CS(=O)(=O)c1cccc(NN2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4S/c1-20(18,19)11-7-5-6-10(12(11)15(16)17)13-14-8-3-2-4-9-14/h5-7,13H,2-4,8-9H2,1H3 |
| InChIKey | YTNLDIVIHKVZCS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|