C13H21N3O4S — CID 82000112
2-ethyl-2-N-(3-methylsulfonyl-2-nitrophenyl)butane-1,2-diamine (PubChem CID 82000112) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-ethyl-2-N-(3-methylsulfonyl-2-nitrophenyl)butane-1,2-diamine.
| Compound Name | 2-ethyl-2-N-(3-methylsulfonyl-2-nitrophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 82000112 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-ethyl-2-N-(3-methylsulfonyl-2-nitrophenyl)butane-1,2-diamine |
| SMILES | CCC(CC)(CN)Nc1cccc(S(C)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O4S/c1-4-13(5-2,9-14)15-10-7-6-8-11(21(3,19)20)12(10)16(17)18/h6-8,15H,4-5,9,14H2,1-3H3 |
| InChIKey | OOQWFOGKMZHCJB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|