C14H22N2O5S — CID 133414263
N-(2-methoxy-3,3-dimethylbutyl)-3-methylsulfonyl-2-nitroaniline (PubChem CID 133414263) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(2-methoxy-3,3-dimethylbutyl)-3-methylsulfonyl-2-nitroaniline.
| Compound Name | N-(2-methoxy-3,3-dimethylbutyl)-3-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 133414263 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(2-methoxy-3,3-dimethylbutyl)-3-methylsulfonyl-2-nitroaniline |
| SMILES | COC(CNc1cccc(S(C)(=O)=O)c1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C14H22N2O5S/c1-14(2,3)12(21-4)9-15-10-7-6-8-11(22(5,19)20)13(10)16(17)18/h6-8,12,15H,9H2,1-5H3 |
| InChIKey | RTVWJOONQFQGBP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|