C15H16N4O6S — CID 133393185
N'-(3-methylsulfonyl-2-nitrophenyl)-N-(4-nitrophenyl)ethane-1,2-diamine (PubChem CID 133393185) has the molecular formula C15H16N4O6S and a molecular weight of 380.38 g/mol. Its IUPAC name is N'-(3-methylsulfonyl-2-nitrophenyl)-N-(4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N'-(3-methylsulfonyl-2-nitrophenyl)-N-(4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133393185 |
| Molecular Formula | C15H16N4O6S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N'-(3-methylsulfonyl-2-nitrophenyl)-N-(4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CS(=O)(=O)c1cccc(NCCNc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O6S/c1-26(24,25)14-4-2-3-13(15(14)19(22)23)17-10-9-16-11-5-7-12(8-6-11)18(20)21/h2-8,16-17H,9-10H2,1H3 |
| InChIKey | SYFGKBALLXFLOU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|