C15H19N5O4S — CID 133414465
3-methylsulfonyl-2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]aniline (PubChem CID 133414465) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-methylsulfonyl-2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]aniline.
| Compound Name | 3-methylsulfonyl-2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 133414465 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-methylsulfonyl-2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]aniline |
| SMILES | CC(Nc1cccc(S(C)(=O)=O)c1[N+](=O)[O-])c1nnc2n1CCCC2 |
| InChI | InChI=1S/C15H19N5O4S/c1-10(15-18-17-13-8-3-4-9-19(13)15)16-11-6-5-7-12(25(2,23)24)14(11)20(21)22/h5-7,10,16H,3-4,8-9H2,1-2H3 |
| InChIKey | JXRWBWCXFLHGII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|