C15H16F3N5O4S — CID 133374598
2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133374598) has the molecular formula C15H16F3N5O4S and a molecular weight of 419.39 g/mol. Its IUPAC name is 2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | 2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133374598 |
| Molecular Formula | C15H16F3N5O4S |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-nitro-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline |
| SMILES | CC(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])c1nnc2n1CCCC2 |
| InChI | InChI=1S/C15H16F3N5O4S/c1-9(14-21-20-13-4-2-3-7-22(13)14)19-11-6-5-10(8-12(11)23(24)25)28(26,27)15(16,17)18/h5-6,8-9,19H,2-4,7H2,1H3 |
| InChIKey | IUMNAWCQVVJXKW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|