C17H13F3N4O5S — CID 133363960
2-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133363960) has the molecular formula C17H13F3N4O5S and a molecular weight of 442.38 g/mol. Its IUPAC name is 2-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | 2-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133363960 |
| Molecular Formula | C17H13F3N4O5S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-nitro-N-[1-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethylsulfonyl)aniline |
| SMILES | CC(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H13F3N4O5S/c1-10(15-22-16(29-23-15)11-5-3-2-4-6-11)21-13-8-7-12(9-14(13)24(25)26)30(27,28)17(18,19)20/h2-10,21H,1H3 |
| InChIKey | UBXUNZSLRPWSLO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|