C14H15F2N3O5S — CID 133312071
4-(difluoromethylsulfonyl)-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-nitroaniline (PubChem CID 133312071) has the molecular formula C14H15F2N3O5S and a molecular weight of 375.35 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133312071 |
| Molecular Formula | C14H15F2N3O5S |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-nitroaniline |
| SMILES | Cc1noc(C)c1C(C)Nc1ccc(S(=O)(=O)C(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15F2N3O5S/c1-7(13-8(2)18-24-9(13)3)17-11-5-4-10(6-12(11)19(20)21)25(22,23)14(15)16/h4-7,14,17H,1-3H3 |
| InChIKey | SOXXPNGZTKXJJC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|