C12H15F2N3O5S — CID 133297222
3-[4-(difluoromethylsulfonyl)-2-nitroanilino]-2,2-dimethylpropanamide (PubChem CID 133297222) has the molecular formula C12H15F2N3O5S and a molecular weight of 351.33 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfonyl)-2-nitroanilino]-2,2-dimethylpropanamide.
| Compound Name | 3-[4-(difluoromethylsulfonyl)-2-nitroanilino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133297222 |
| Molecular Formula | C12H15F2N3O5S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-[4-(difluoromethylsulfonyl)-2-nitroanilino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1ccc(S(=O)(=O)C(F)F)cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C12H15F2N3O5S/c1-12(2,10(15)18)6-16-8-4-3-7(5-9(8)17(19)20)23(21,22)11(13)14/h3-5,11,16H,6H2,1-2H3,(H2,15,18) |
| InChIKey | OYHRKSWEJGMTNQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|