C14H18F2N4O4S — CID 133399716
N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-4-(difluoromethylsulfonyl)-2-nitroaniline (PubChem CID 133399716) has the molecular formula C14H18F2N4O4S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-4-(difluoromethylsulfonyl)-2-nitroaniline.
| Compound Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-4-(difluoromethylsulfonyl)-2-nitroaniline |
|---|---|
| PubChem CID | 133399716 |
| Molecular Formula | C14H18F2N4O4S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-4-(difluoromethylsulfonyl)-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)F)ccc1NCC1CN2CCN1CC2 |
| InChI | InChI=1S/C14H18F2N4O4S/c15-14(16)25(23,24)11-1-2-12(13(7-11)20(21)22)17-8-10-9-18-3-5-19(10)6-4-18/h1-2,7,10,14,17H,3-6,8-9H2 |
| InChIKey | AHAWENVZKDKBTO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|