C20H22N4O3 — CID 133399676
[4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone (PubChem CID 133399676) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is [4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 133399676 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(NCC2CN3CCN2CC3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N4O3/c25-20(15-4-2-1-3-5-15)16-6-7-18(19(12-16)24(26)27)21-13-17-14-22-8-10-23(17)11-9-22/h1-7,12,17,21H,8-11,13-14H2 |
| InChIKey | LZMWFQPUWKICDR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|