C19H24N4O6S — CID 174952672
methanesulfonamide;[4-(morpholin-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone (PubChem CID 174952672) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is methanesulfonamide;[4-(morpholin-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone.
| Compound Name | methanesulfonamide;[4-(morpholin-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 174952672 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methanesulfonamide;[4-(morpholin-2-ylmethylamino)-3-nitrophenyl]-phenylmethanone |
| SMILES | CS(N)(=O)=O.O=C(c1ccccc1)c1ccc(NCC2CNCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O4.CH5NO2S/c22-18(13-4-2-1-3-5-13)14-6-7-16(17(10-14)21(23)24)20-12-15-11-19-8-9-25-15;1-5(2,3)4/h1-7,10,15,19-20H,8-9,11-12H2;1H3,(H2,2,3,4) |
| InChIKey | SDFNRKUYOLHBCQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|