C26H28N4O4 — CID 51961110
[4-[[6-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]-3-pyridinyl]methylamino]-3-nitrophenyl]-phenylmethanone (PubChem CID 51961110) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is [4-[[6-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]-3-pyridinyl]methylamino]-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-[[6-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]-3-pyridinyl]methylamino]-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 51961110 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [4-[[6-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]-3-pyridinyl]methylamino]-3-nitrophenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(NCc2ccc(N3CCCC[C@@H]3CCO)nc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28N4O4/c31-15-13-22-8-4-5-14-29(22)25-12-9-19(18-28-25)17-27-23-11-10-21(16-24(23)30(33)34)26(32)20-6-2-1-3-7-20/h1-3,6-7,9-12,16,18,22,27,31H,4-5,8,13-15,17H2/t22-/m1/s1 |
| InChIKey | QQPXQMLEQBSWPS-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|