C18H23N5O3 — CID 47049237
2-[1-[5-[[(3-nitro-2-pyridinyl)amino]methyl]-2-pyridinyl]piperidin-2-yl]ethanol (PubChem CID 47049237) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[1-[5-[[(3-nitro-2-pyridinyl)amino]methyl]-2-pyridinyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[5-[[(3-nitro-2-pyridinyl)amino]methyl]-2-pyridinyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 47049237 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-[1-[5-[[(3-nitro-2-pyridinyl)amino]methyl]-2-pyridinyl]piperidin-2-yl]ethanol |
| SMILES | O=[N+]([O-])c1cccnc1NCc1ccc(N2CCCCC2CCO)nc1 |
| InChI | InChI=1S/C18H23N5O3/c24-11-8-15-4-1-2-10-22(15)17-7-6-14(12-20-17)13-21-18-16(23(25)26)5-3-9-19-18/h3,5-7,9,12,15,24H,1-2,4,8,10-11,13H2,(H,19,21) |
| InChIKey | KOWVYTZJOIKDRE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|