C19H23N5O3 — CID 55829238
4-[[6-(azepan-1-yl)-3-pyridinyl]methylamino]-3-nitrobenzamide (PubChem CID 55829238) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-[[6-(azepan-1-yl)-3-pyridinyl]methylamino]-3-nitrobenzamide.
| Compound Name | 4-[[6-(azepan-1-yl)-3-pyridinyl]methylamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55829238 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-[[6-(azepan-1-yl)-3-pyridinyl]methylamino]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(NCc2ccc(N3CCCCCC3)nc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N5O3/c20-19(25)15-6-7-16(17(11-15)24(26)27)21-12-14-5-8-18(22-13-14)23-9-3-1-2-4-10-23/h5-8,11,13,21H,1-4,9-10,12H2,(H2,20,25) |
| InChIKey | RNTVEKUICQTYJK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|