C17H23N5O3 — CID 133399750
N-cyclopropyl-4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrobenzamide (PubChem CID 133399750) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-cyclopropyl-4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 133399750 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-cyclopropyl-4-(1,4-diazabicyclo[2.2.2]octan-2-ylmethylamino)-3-nitrobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(NCC2CN3CCN2CC3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H23N5O3/c23-17(19-13-2-3-13)12-1-4-15(16(9-12)22(24)25)18-10-14-11-20-5-7-21(14)8-6-20/h1,4,9,13-14,18H,2-3,5-8,10-11H2,(H,19,23) |
| InChIKey | MYURUICKRROSDM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|