C22H26N4O3 — CID 133439652
N-cyclopropyl-3-nitro-4-[(2-piperidin-1-ylphenyl)methylamino]benzamide (PubChem CID 133439652) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-cyclopropyl-3-nitro-4-[(2-piperidin-1-ylphenyl)methylamino]benzamide.
| Compound Name | N-cyclopropyl-3-nitro-4-[(2-piperidin-1-ylphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 133439652 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-cyclopropyl-3-nitro-4-[(2-piperidin-1-ylphenyl)methylamino]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(NCc2ccccc2N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N4O3/c27-22(24-18-9-10-18)16-8-11-19(21(14-16)26(28)29)23-15-17-6-2-3-7-20(17)25-12-4-1-5-13-25/h2-3,6-8,11,14,18,23H,1,4-5,9-10,12-13,15H2,(H,24,27) |
| InChIKey | CWJBPNQXVZQHML-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|