C20H21N3O5 — CID 133286961
N-cyclopropyl-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylamino)-3-nitrobenzamide (PubChem CID 133286961) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-cyclopropyl-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylamino)-3-nitrobenzamide.
| Compound Name | N-cyclopropyl-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 133286961 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-cyclopropyl-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylamino)-3-nitrobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(NCc2ccc3c(c2)OCCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O5/c24-20(22-15-4-5-15)14-3-6-16(17(11-14)23(25)26)21-12-13-2-7-18-19(10-13)28-9-1-8-27-18/h2-3,6-7,10-11,15,21H,1,4-5,8-9,12H2,(H,22,24) |
| InChIKey | HDQLYSBLQXHPOI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|