C17H15F3N2O4 — CID 75415547
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 75415547) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 75415547 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H15F3N2O4/c18-17(19,20)12-3-4-13(14(9-12)22(23)24)21-10-11-2-5-15-16(8-11)26-7-1-6-25-15/h2-5,8-9,21H,1,6-7,10H2 |
| InChIKey | HOLVMKKMZARUDP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|