C21H20F3N3O7 — CID 16591950
[2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 16591950) has the molecular formula C21H20F3N3O7 and a molecular weight of 483.40 g/mol. Its IUPAC name is [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 16591950 |
| Molecular Formula | C21H20F3N3O7 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(COC(=O)CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H20F3N3O7/c22-21(23,24)14-2-3-15(16(10-14)27(30)31)26-11-20(29)34-12-19(28)25-6-5-13-1-4-17-18(9-13)33-8-7-32-17/h1-4,9-10,26H,5-8,11-12H2,(H,25,28) |
| InChIKey | VDYHNTBPJDXFLF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|