C14H13F3N4O6 — CID 7175615
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 7175615) has the molecular formula C14H13F3N4O6 and a molecular weight of 390.27 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 7175615 |
| Molecular Formula | C14H13F3N4O6 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H13F3N4O6/c15-14(16,17)8-1-2-9(10(5-8)21(25)26)19-6-12(23)27-7-11(22)20-4-3-18-13(20)24/h1-2,5,19H,3-4,6-7H2,(H,18,24) |
| InChIKey | FWGAJFHCWFZJDE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|