C19H17F3N4O5 — CID 16502381
3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 16502381) has the molecular formula C19H17F3N4O5 and a molecular weight of 438.36 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 16502381 |
| Molecular Formula | C19H17F3N4O5 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCCCn1c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C19H17F3N4O5/c20-19(21,22)12-6-7-13(16(10-12)26(29)30)23-11-17(27)31-9-3-8-25-15-5-2-1-4-14(15)24-18(25)28/h1-2,4-7,10,23H,3,8-9,11H2,(H,24,28) |
| InChIKey | GMUDOYWAFYUDJO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|