C17H12BrF3N2O5 — CID 4673786
[2-(4-bromophenyl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 4673786) has the molecular formula C17H12BrF3N2O5 and a molecular weight of 461.19 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 4673786 |
| Molecular Formula | C17H12BrF3N2O5 |
| Molecular Weight | 461.19 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrF3N2O5/c18-12-4-1-10(2-5-12)15(24)9-28-16(25)8-22-13-6-3-11(17(19,20)21)7-14(13)23(26)27/h1-7,22H,8-9H2 |
| InChIKey | ZTMYUHQNFUECDG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|