C19H14F3N3O5 — CID 3450331
[2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 3450331) has the molecular formula C19H14F3N3O5 and a molecular weight of 421.33 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 3450331 |
| Molecular Formula | C19H14F3N3O5 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14F3N3O5/c20-19(21,22)11-5-6-15(16(7-11)25(28)29)24-9-18(27)30-10-17(26)13-8-23-14-4-2-1-3-12(13)14/h1-8,23-24H,9-10H2 |
| InChIKey | NBTGYBHFZRTDFY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|