C18H22F3N3O5 — CID 7148792
[2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 7148792) has the molecular formula C18H22F3N3O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 7148792 |
| Molecular Formula | C18H22F3N3O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [2-[(2R)-2-ethylpiperidin-1-yl]-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | CC[C@@H]1CCCCN1C(=O)COC(=O)CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22F3N3O5/c1-2-13-5-3-4-8-23(13)16(25)11-29-17(26)10-22-14-7-6-12(18(19,20)21)9-15(14)24(27)28/h6-7,9,13,22H,2-5,8,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | CENFLYBIQUIFEV-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|