C12H12F3N3O5 — CID 18284930
(3-amino-3-oxopropyl) 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 18284930) has the molecular formula C12H12F3N3O5 and a molecular weight of 335.24 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | (3-amino-3-oxopropyl) 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 18284930 |
| Molecular Formula | C12H12F3N3O5 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (3-amino-3-oxopropyl) 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | NC(=O)CCOC(=O)CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3N3O5/c13-12(14,15)7-1-2-8(9(5-7)18(21)22)17-6-11(20)23-4-3-10(16)19/h1-2,5,17H,3-4,6H2,(H2,16,19) |
| InChIKey | DEKTXOLGLNMDHI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|