C15H16F3N3O5 — CID 7148774
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 7148774) has the molecular formula C15H16F3N3O5 and a molecular weight of 375.30 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 7148774 |
| Molecular Formula | C15H16F3N3O5 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | C[C@H](OC(=O)CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)NC1CC1 |
| InChI | InChI=1S/C15H16F3N3O5/c1-8(14(23)20-10-3-4-10)26-13(22)7-19-11-5-2-9(15(16,17)18)6-12(11)21(24)25/h2,5-6,8,10,19H,3-4,7H2,1H3,(H,20,23)/t8-/m0/s1 |
| InChIKey | WMIXCZCULIBIGN-QMMMGPOBSA-N |
| XLogP | 2.24 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|