C16H18F3N3O5 — CID 7566909
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 7566909) has the molecular formula C16H18F3N3O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 7566909 |
| Molecular Formula | C16H18F3N3O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | C[C@H](Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)O[C@@H](C)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H18F3N3O5/c1-8(15(24)27-9(2)14(23)21-11-4-5-11)20-12-6-3-10(16(17,18)19)7-13(12)22(25)26/h3,6-9,11,20H,4-5H2,1-2H3,(H,21,23)/t8-,9-/m0/s1 |
| InChIKey | VVGGJZZKDWAAPQ-IUCAKERBSA-N |
| XLogP | 2.62 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|