C17H14ClF3N2O4 — CID 7611751
(4-chloro-2-methylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 7611751) has the molecular formula C17H14ClF3N2O4 and a molecular weight of 402.76 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | (4-chloro-2-methylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 7611751 |
| Molecular Formula | C17H14ClF3N2O4 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (4-chloro-2-methylphenyl) (2S)-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClF3N2O4/c1-9-7-12(18)4-6-15(9)27-16(24)10(2)22-13-5-3-11(17(19,20)21)8-14(13)23(25)26/h3-8,10,22H,1-2H3/t10-/m0/s1 |
| InChIKey | VRANGPLGSYLOFC-JTQLQIEISA-N |
| XLogP | 4.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|