C18H18F3N3O5 — CID 7611553
(2S)-N-(2,5-dimethoxyphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 7611553) has the molecular formula C18H18F3N3O5 and a molecular weight of 413.35 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethoxyphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | (2S)-N-(2,5-dimethoxyphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 7611553 |
| Molecular Formula | C18H18F3N3O5 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (2S)-N-(2,5-dimethoxyphenyl)-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@H](C)Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18F3N3O5/c1-10(17(25)23-14-9-12(28-2)5-7-16(14)29-3)22-13-6-4-11(18(19,20)21)8-15(13)24(26)27/h4-10,22H,1-3H3,(H,23,25)/t10-/m0/s1 |
| InChIKey | NYUJBXFRHHFTMP-JTQLQIEISA-N |
| XLogP | 4.07 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|