C14H16F3N3O4 — CID 78777112
1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 78777112) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 78777112 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-morpholin-4-yl-2-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | CC(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H16F3N3O4/c1-9(13(21)19-4-6-24-7-5-19)18-11-3-2-10(14(15,16)17)8-12(11)20(22)23/h2-3,8-9,18H,4-7H2,1H3 |
| InChIKey | QVXYKHQZAFEKMT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|