C13H14F3N3O4 — CID 51192645
N'-[2-nitro-4-(trifluoromethyl)phenyl]oxane-4-carbohydrazide (PubChem CID 51192645) has the molecular formula C13H14F3N3O4 and a molecular weight of 333.27 g/mol. Its IUPAC name is N'-[2-nitro-4-(trifluoromethyl)phenyl]oxane-4-carbohydrazide.
| Compound Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]oxane-4-carbohydrazide |
|---|---|
| PubChem CID | 51192645 |
| Molecular Formula | C13H14F3N3O4 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N'-[2-nitro-4-(trifluoromethyl)phenyl]oxane-4-carbohydrazide |
| SMILES | O=C(NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C1CCOCC1 |
| InChI | InChI=1S/C13H14F3N3O4/c14-13(15,16)9-1-2-10(11(7-9)19(21)22)17-18-12(20)8-3-5-23-6-4-8/h1-2,7-8,17H,3-6H2,(H,18,20) |
| InChIKey | BKAWJWDPBNXDSM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|