C14H12F3N3O4 — CID 29409438
2,5-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-3-carbohydrazide (PubChem CID 29409438) has the molecular formula C14H12F3N3O4 and a molecular weight of 343.26 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 29409438 |
| Molecular Formula | C14H12F3N3O4 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2,5-dimethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(C)o1 |
| InChI | InChI=1S/C14H12F3N3O4/c1-7-5-10(8(2)24-7)13(21)19-18-11-4-3-9(14(15,16)17)6-12(11)20(22)23/h3-6,18H,1-2H3,(H,19,21) |
| InChIKey | MMGGYPDFYYEODD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|